C12H16ClN3O — CID 169090326
2-(chloromethyl)-3-(oxan-4-yl)-1,2-dihydroimidazo[4,5-c]pyridine (PubChem CID 169090326) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(oxan-4-yl)-1,2-dihydroimidazo[4,5-c]pyridine.
| Compound Name | 2-(chloromethyl)-3-(oxan-4-yl)-1,2-dihydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 169090326 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-(chloromethyl)-3-(oxan-4-yl)-1,2-dihydroimidazo[4,5-c]pyridine |
| SMILES | ClCC1Nc2ccncc2N1C1CCOCC1 |
| InChI | InChI=1S/C12H16ClN3O/c13-7-12-15-10-1-4-14-8-11(10)16(12)9-2-5-17-6-3-9/h1,4,8-9,12,15H,2-3,5-7H2 |
| InChIKey | JWXORQHPVCSKAQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|