C6H5I2N3 — CID 166714784
2,3-diiodo-1,2-dihydroimidazo[4,5-c]pyridine (PubChem CID 166714784) has the molecular formula C6H5I2N3 and a molecular weight of 372.94 g/mol. Its IUPAC name is 2,3-diiodo-1,2-dihydroimidazo[4,5-c]pyridine.
| Compound Name | 2,3-diiodo-1,2-dihydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 166714784 |
| Molecular Formula | C6H5I2N3 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.86 |
| IUPAC Name | 2,3-diiodo-1,2-dihydroimidazo[4,5-c]pyridine |
| SMILES | IC1Nc2ccncc2N1I |
| InChI | InChI=1S/C6H5I2N3/c7-6-10-4-1-2-9-3-5(4)11(6)8/h1-3,6,10H |
| InChIKey | APDQLYUYZGECML-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|