C11H8IN3 — CID 170081634
5-iodo-10H-pyrido[4,3-b][1,6]naphthyridine (PubChem CID 170081634) has the molecular formula C11H8IN3 and a molecular weight of 309.11 g/mol. Its IUPAC name is 5-iodo-10H-pyrido[4,3-b][1,6]naphthyridine.
| Compound Name | 5-iodo-10H-pyrido[4,3-b][1,6]naphthyridine |
|---|---|
| PubChem CID | 170081634 |
| Molecular Formula | C11H8IN3 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 5-iodo-10H-pyrido[4,3-b][1,6]naphthyridine |
| SMILES | IN1c2ccncc2Cc2cnccc21 |
| InChI | InChI=1S/C11H8IN3/c12-15-10-1-3-13-6-8(10)5-9-7-14-4-2-11(9)15/h1-4,6-7H,5H2 |
| InChIKey | PZFFANGYLVECRJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|