C8H10N2O — CID 140792897
1,2,3,4-tetrahydro-1,6-naphthyridin-2-ol (PubChem CID 140792897) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 1,2,3,4-tetrahydro-1,6-naphthyridin-2-ol.
| Compound Name | 1,2,3,4-tetrahydro-1,6-naphthyridin-2-ol |
|---|---|
| PubChem CID | 140792897 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1,2,3,4-tetrahydro-1,6-naphthyridin-2-ol |
| SMILES | OC1CCc2cnccc2N1 |
| InChI | InChI=1S/C8H10N2O/c11-8-2-1-6-5-9-4-3-7(6)10-8/h3-5,8,10-11H,1-2H2 |
| InChIKey | SAUIQHXPAQPBJM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |