C9H10ClN — CID 124706971
(5S)-5-chloro-5,6,7,8-tetrahydroisoquinoline (PubChem CID 124706971) has the molecular formula C9H10ClN and a molecular weight of 167.64 g/mol. Its IUPAC name is (5S)-5-chloro-5,6,7,8-tetrahydroisoquinoline.
| Compound Name | (5S)-5-chloro-5,6,7,8-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 124706971 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | (5S)-5-chloro-5,6,7,8-tetrahydroisoquinoline |
| SMILES | Cl[C@H]1CCCc2cnccc21 |
| InChI | InChI=1S/C9H10ClN/c10-9-3-1-2-7-6-11-5-4-8(7)9/h4-6,9H,1-3H2/t9-/m0/s1 |
| InChIKey | MKKSBYCWYRRKAR-VIFPVBQESA-N |
| XLogP | 2.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|