C14H13ClN2 — CID 166068550
1-chloro-2-phenyl-3,4-dihydro-1H-2,6-naphthyridine (PubChem CID 166068550) has the molecular formula C14H13ClN2 and a molecular weight of 244.73 g/mol. Its IUPAC name is 1-chloro-2-phenyl-3,4-dihydro-1H-2,6-naphthyridine.
| Compound Name | 1-chloro-2-phenyl-3,4-dihydro-1H-2,6-naphthyridine |
|---|---|
| PubChem CID | 166068550 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-chloro-2-phenyl-3,4-dihydro-1H-2,6-naphthyridine |
| SMILES | ClC1c2ccncc2CCN1c1ccccc1 |
| InChI | InChI=1S/C14H13ClN2/c15-14-13-6-8-16-10-11(13)7-9-17(14)12-4-2-1-3-5-12/h1-6,8,10,14H,7,9H2 |
| InChIKey | OVJFZSGUCOMUQB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|