C17H27N — CID 143716647
5-ethyl-5,6,7,8,9,10,11,12,13,14-decahydrocyclododeca[c]pyridine (PubChem CID 143716647) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 5-ethyl-5,6,7,8,9,10,11,12,13,14-decahydrocyclododeca[c]pyridine.
| Compound Name | 5-ethyl-5,6,7,8,9,10,11,12,13,14-decahydrocyclododeca[c]pyridine |
|---|---|
| PubChem CID | 143716647 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 5-ethyl-5,6,7,8,9,10,11,12,13,14-decahydrocyclododeca[c]pyridine |
| SMILES | CCC1CCCCCCCCCc2cnccc21 |
| InChI | InChI=1S/C17H27N/c1-2-15-10-8-6-4-3-5-7-9-11-16-14-18-13-12-17(15)16/h12-15H,2-11H2,1H3 |
| InChIKey | XMDYCXBJJJLURR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |