C11H15N3 — CID 130986112
3-cyclobutyl-1,2,3,4-tetrahydropyrido[3,4-b]pyrazine (PubChem CID 130986112) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-cyclobutyl-1,2,3,4-tetrahydropyrido[3,4-b]pyrazine.
| Compound Name | 3-cyclobutyl-1,2,3,4-tetrahydropyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 130986112 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-cyclobutyl-1,2,3,4-tetrahydropyrido[3,4-b]pyrazine |
| SMILES | c1cc2c(cn1)NC(C1CCC1)CN2 |
| InChI | InChI=1S/C11H15N3/c1-2-8(3-1)10-7-13-9-4-5-12-6-11(9)14-10/h4-6,8,10,13-14H,1-3,7H2 |
| InChIKey | QWVUCEBQEOIPNZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |