C13H17N3 — CID 10176756
4-cyclohexyl-1,4-dihydropyrido[4,3-d]pyrimidine (PubChem CID 10176756) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-cyclohexyl-1,4-dihydropyrido[4,3-d]pyrimidine.
| Compound Name | 4-cyclohexyl-1,4-dihydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 10176756 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 4-cyclohexyl-1,4-dihydropyrido[4,3-d]pyrimidine |
| SMILES | C1=NC(C2CCCCC2)c2cnccc2N1 |
| InChI | InChI=1S/C13H17N3/c1-2-4-10(5-3-1)13-11-8-14-7-6-12(11)15-9-16-13/h6-10,13H,1-5H2,(H,15,16) |
| InChIKey | IAPMXGMRGMMROU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |