C14H19FN2 — CID 112740816
2-cyclohexyl-8-fluoro-1,2,3,4-tetrahydroquinoxaline (PubChem CID 112740816) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-cyclohexyl-8-fluoro-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 2-cyclohexyl-8-fluoro-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 112740816 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-cyclohexyl-8-fluoro-1,2,3,4-tetrahydroquinoxaline |
| SMILES | Fc1cccc2c1NC(C1CCCCC1)CN2 |
| InChI | InChI=1S/C14H19FN2/c15-11-7-4-8-12-14(11)17-13(9-16-12)10-5-2-1-3-6-10/h4,7-8,10,13,16-17H,1-3,5-6,9H2 |
| InChIKey | ZLVTYFZVDSAPKC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |