C11H15ClN4O — CID 135151358
2-chloro-7-methyl-9-[(3R)-oxan-3-yl]-8H-purine (PubChem CID 135151358) has the molecular formula C11H15ClN4O and a molecular weight of 254.72 g/mol. Its IUPAC name is 2-chloro-7-methyl-9-[(3R)-oxan-3-yl]-8H-purine.
| Compound Name | 2-chloro-7-methyl-9-[(3R)-oxan-3-yl]-8H-purine |
|---|---|
| PubChem CID | 135151358 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-chloro-7-methyl-9-[(3R)-oxan-3-yl]-8H-purine |
| SMILES | CN1CN([C@@H]2CCCOC2)c2nc(Cl)ncc21 |
| InChI | InChI=1S/C11H15ClN4O/c1-15-7-16(8-3-2-4-17-6-8)10-9(15)5-13-11(12)14-10/h5,8H,2-4,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | UOFUGWQWSVWNDX-MRVPVSSYSA-N |
| XLogP | 1.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |