About (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine
(7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine (PubChem CID 59765793) has the molecular formula C14H21ClN4
and a molecular weight of 280.80 g/mol. Its IUPAC name is (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine.
Molecular Properties
| Compound Name | (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine |
| PubChem CID | 59765793 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine |
| SMILES | CC[C@@H]1CN(C)c2cnc(Cl)nc2N1C1CCCC1 |
| InChI | InChI=1S/C14H21ClN4/c1-3-10-9-18(2)12-8-16-14(15)17-13(12)19(10)11-6-4-5-7-11/h8,10-11H,3-7,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | RRSQYQYUILNUCI-SNVBAGLBSA-N |
| XLogP | 3.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine?
The IUPAC name of (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine (CID 59765793) is (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine.
What is the SMILES notation for (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine?
The canonical SMILES for (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine is CC[C@@H]1CN(C)c2cnc(Cl)nc2N1C1CCCC1.
What is the InChIKey of (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine?
The InChIKey is RRSQYQYUILNUCI-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H21ClN4/c1-3-10-9-18(2)12-8-16-14(15)17-13(12)19(10)11-6-4-5-7-11/h8,10-11H,3-7,9H2,1-2H3/t10-/m1/s1.
What are the key properties of (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine?
(7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine has a molecular weight of 280.80 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-2-chloro-8-cyclopentyl-7-ethyl-5-methyl-6,7-dihydropteridine is sourced from PubChem (CID 59765793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).