C15H18ClN5 — CID 59286705
(6R)-3-chloro-5-cyclopentyl-6-ethyl-6H-imidazo[1,5-f]pteridine (PubChem CID 59286705) has the molecular formula C15H18ClN5 and a molecular weight of 303.80 g/mol. Its IUPAC name is (6R)-3-chloro-5-cyclopentyl-6-ethyl-6H-imidazo[1,5-f]pteridine.
| Compound Name | (6R)-3-chloro-5-cyclopentyl-6-ethyl-6H-imidazo[1,5-f]pteridine |
|---|---|
| PubChem CID | 59286705 |
| Molecular Formula | C15H18ClN5 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (6R)-3-chloro-5-cyclopentyl-6-ethyl-6H-imidazo[1,5-f]pteridine |
| SMILES | CC[C@@H]1c2cncn2-c2cnc(Cl)nc2N1C1CCCC1 |
| InChI | InChI=1S/C15H18ClN5/c1-2-11-12-7-17-9-20(12)13-8-18-15(16)19-14(13)21(11)10-5-3-4-6-10/h7-11H,2-6H2,1H3/t11-/m1/s1 |
| InChIKey | OKUQGBGHLHSNGQ-LLVKDONJSA-N |
| XLogP | 3.53 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |