C19H27N7 — CID 66672557
N,5-dicyclopentyl-4-ethyl-4H-[1,2,4]triazolo[4,3-f]pteridin-7-amine (PubChem CID 66672557) has the molecular formula C19H27N7 and a molecular weight of 353.47 g/mol. Its IUPAC name is N,5-dicyclopentyl-4-ethyl-4H-[1,2,4]triazolo[4,3-f]pteridin-7-amine.
| Compound Name | N,5-dicyclopentyl-4-ethyl-4H-[1,2,4]triazolo[4,3-f]pteridin-7-amine |
|---|---|
| PubChem CID | 66672557 |
| Molecular Formula | C19H27N7 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | N,5-dicyclopentyl-4-ethyl-4H-[1,2,4]triazolo[4,3-f]pteridin-7-amine |
| SMILES | CCC1c2nncn2-c2cnc(NC3CCCC3)nc2N1C1CCCC1 |
| InChI | InChI=1S/C19H27N7/c1-2-15-18-24-21-12-25(18)16-11-20-19(22-13-7-3-4-8-13)23-17(16)26(15)14-9-5-6-10-14/h11-15H,2-10H2,1H3,(H,20,22,23) |
| InChIKey | PANLPXCOOSGLCK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |