C19H21N7O — CID 67499872
(4R)-5-cyclopentyl-4-ethyl-7-(1-oxidopyridin-1-ium-4-yl)-4H-[1,2,4]triazolo[4,3-f]pteridine (PubChem CID 67499872) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is (4R)-5-cyclopentyl-4-ethyl-7-(1-oxidopyridin-1-ium-4-yl)-4H-[1,2,4]triazolo[4,3-f]pteridine.
| Compound Name | (4R)-5-cyclopentyl-4-ethyl-7-(1-oxidopyridin-1-ium-4-yl)-4H-[1,2,4]triazolo[4,3-f]pteridine |
|---|---|
| PubChem CID | 67499872 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (4R)-5-cyclopentyl-4-ethyl-7-(1-oxidopyridin-1-ium-4-yl)-4H-[1,2,4]triazolo[4,3-f]pteridine |
| SMILES | CC[C@@H]1c2nncn2-c2cnc(-c3cc[n+]([O-])cc3)nc2N1C1CCCC1 |
| InChI | InChI=1S/C19H21N7O/c1-2-15-19-23-21-12-25(19)16-11-20-17(13-7-9-24(27)10-8-13)22-18(16)26(15)14-5-3-4-6-14/h7-12,14-15H,2-6H2,1H3/t15-/m1/s1 |
| InChIKey | QCERFCJHUXMSKD-OAHLLOKOSA-N |
| XLogP | 2.57 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|