C22H23N7 — CID 66979801
(4R)-5-cyclopentyl-4-ethyl-7-indol-1-yl-4H-[1,2,4]triazolo[4,3-f]pteridine (PubChem CID 66979801) has the molecular formula C22H23N7 and a molecular weight of 385.48 g/mol. Its IUPAC name is (4R)-5-cyclopentyl-4-ethyl-7-indol-1-yl-4H-[1,2,4]triazolo[4,3-f]pteridine.
| Compound Name | (4R)-5-cyclopentyl-4-ethyl-7-indol-1-yl-4H-[1,2,4]triazolo[4,3-f]pteridine |
|---|---|
| PubChem CID | 66979801 |
| Molecular Formula | C22H23N7 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (4R)-5-cyclopentyl-4-ethyl-7-indol-1-yl-4H-[1,2,4]triazolo[4,3-f]pteridine |
| SMILES | CC[C@@H]1c2nncn2-c2cnc(-n3ccc4ccccc43)nc2N1C1CCCC1 |
| InChI | InChI=1S/C22H23N7/c1-2-17-21-26-24-14-28(21)19-13-23-22(25-20(19)29(17)16-8-4-5-9-16)27-12-11-15-7-3-6-10-18(15)27/h3,6-7,10-14,16-17H,2,4-5,8-9H2,1H3/t17-/m1/s1 |
| InChIKey | NBIONEYWKUYCRY-QGZVFWFLSA-N |
| XLogP | 4.21 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |