C14H18N6 — CID 123214877
5-cyclopentyl-4-ethyl-4H-[1,2,4]triazolo[4,3-f]pteridine (PubChem CID 123214877) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is 5-cyclopentyl-4-ethyl-4H-[1,2,4]triazolo[4,3-f]pteridine.
| Compound Name | 5-cyclopentyl-4-ethyl-4H-[1,2,4]triazolo[4,3-f]pteridine |
|---|---|
| PubChem CID | 123214877 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 5-cyclopentyl-4-ethyl-4H-[1,2,4]triazolo[4,3-f]pteridine |
| SMILES | CCC1c2nncn2-c2cncnc2N1C1CCCC1 |
| InChI | InChI=1S/C14H18N6/c1-2-11-14-18-17-9-19(14)12-7-15-8-16-13(12)20(11)10-5-3-4-6-10/h7-11H,2-6H2,1H3 |
| InChIKey | ZGBUWHJSAXSQDY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |