C15H20N6 — CID 77151093
5-cyclopentyl-6-ethyl-6H-imidazo[1,5-f]pteridin-3-amine (PubChem CID 77151093) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 5-cyclopentyl-6-ethyl-6H-imidazo[1,5-f]pteridin-3-amine.
| Compound Name | 5-cyclopentyl-6-ethyl-6H-imidazo[1,5-f]pteridin-3-amine |
|---|---|
| PubChem CID | 77151093 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 5-cyclopentyl-6-ethyl-6H-imidazo[1,5-f]pteridin-3-amine |
| SMILES | CCC1c2cncn2-c2cnc(N)nc2N1C1CCCC1 |
| InChI | InChI=1S/C15H20N6/c1-2-11-12-7-17-9-20(12)13-8-18-15(16)19-14(13)21(11)10-5-3-4-6-10/h7-11H,2-6H2,1H3,(H2,16,18,19) |
| InChIKey | PUENLGSMTMFWFD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |