C14H21N7 — CID 143563235
(7R)-8-cyclopentyl-7-ethyl-6-imino-5-methanimidoyl-7H-pteridin-2-amine (PubChem CID 143563235) has the molecular formula C14H21N7 and a molecular weight of 287.37 g/mol. Its IUPAC name is (7R)-8-cyclopentyl-7-ethyl-6-imino-5-methanimidoyl-7H-pteridin-2-amine.
| Compound Name | (7R)-8-cyclopentyl-7-ethyl-6-imino-5-methanimidoyl-7H-pteridin-2-amine |
|---|---|
| PubChem CID | 143563235 |
| Molecular Formula | C14H21N7 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (7R)-8-cyclopentyl-7-ethyl-6-imino-5-methanimidoyl-7H-pteridin-2-amine |
| SMILES | [H]/N=C/N1/C(=N/[H])[C@@H](CC)N(C2CCCC2)c2nc(N)ncc21 |
| InChI | InChI=1S/C14H21N7/c1-2-10-12(16)20(8-15)11-7-18-14(17)19-13(11)21(10)9-5-3-4-6-9/h7-10,15-16H,2-6H2,1H3,(H2,17,18,19)/b15-8+,16-12+/t10-/m1/s1 |
| InChIKey | ZEHXMSHOPONXIT-UGFYYEECSA-N |
| XLogP | 1.99 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|