C22H31N5O — CID 171081682
8-cyclopentyl-7-ethyl-5-methyl-2-[[(3E,5Z)-octa-1,3,5-trien-3-yl]amino]-7H-pteridin-6-one (PubChem CID 171081682) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 8-cyclopentyl-7-ethyl-5-methyl-2-[[(3E,5Z)-octa-1,3,5-trien-3-yl]amino]-7H-pteridin-6-one.
| Compound Name | 8-cyclopentyl-7-ethyl-5-methyl-2-[[(3E,5Z)-octa-1,3,5-trien-3-yl]amino]-7H-pteridin-6-one |
|---|---|
| PubChem CID | 171081682 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 8-cyclopentyl-7-ethyl-5-methyl-2-[[(3E,5Z)-octa-1,3,5-trien-3-yl]amino]-7H-pteridin-6-one |
| SMILES | C=C/C(=C\C=C/CC)Nc1ncc2c(n1)N(C1CCCC1)C(CC)C(=O)N2C |
| InChI | InChI=1S/C22H31N5O/c1-5-8-9-12-16(6-2)24-22-23-15-19-20(25-22)27(17-13-10-11-14-17)18(7-3)21(28)26(19)4/h6,8-9,12,15,17-18H,2,5,7,10-11,13-14H2,1,3-4H3,(H,23,24,25)/b9-8-,16-12+ |
| InChIKey | ALCNWRKBWGHFFT-JHKMCZGTSA-N |
| XLogP | 4.43 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|