C25H28N6O — CID 175354008
8-cyclopentyl-7-ethyl-5-methyl-2-[2-(naphthalen-1-ylmethylidene)hydrazinyl]-7H-pteridin-6-one (PubChem CID 175354008) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 8-cyclopentyl-7-ethyl-5-methyl-2-[2-(naphthalen-1-ylmethylidene)hydrazinyl]-7H-pteridin-6-one.
| Compound Name | 8-cyclopentyl-7-ethyl-5-methyl-2-[2-(naphthalen-1-ylmethylidene)hydrazinyl]-7H-pteridin-6-one |
|---|---|
| PubChem CID | 175354008 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 8-cyclopentyl-7-ethyl-5-methyl-2-[2-(naphthalen-1-ylmethylidene)hydrazinyl]-7H-pteridin-6-one |
| SMILES | CCC1C(=O)N(C)c2cnc(NN=Cc3cccc4ccccc34)nc2N1C1CCCC1 |
| InChI | InChI=1S/C25H28N6O/c1-3-21-24(32)30(2)22-16-26-25(28-23(22)31(21)19-12-5-6-13-19)29-27-15-18-11-8-10-17-9-4-7-14-20(17)18/h4,7-11,14-16,19,21H,3,5-6,12-13H2,1-2H3,(H,26,28,29) |
| InChIKey | BWWQUWGZBNYWFI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|