C21H21FN8O — CID 123556404
7-ethyl-2-[2-(4-fluorophenyl)imidazol-1-yl]-5-methanimidoyl-8-(oxetan-3-yl)-7H-pteridin-6-imine (PubChem CID 123556404) has the molecular formula C21H21FN8O and a molecular weight of 420.45 g/mol. Its IUPAC name is 7-ethyl-2-[2-(4-fluorophenyl)imidazol-1-yl]-5-methanimidoyl-8-(oxetan-3-yl)-7H-pteridin-6-imine.
| Compound Name | 7-ethyl-2-[2-(4-fluorophenyl)imidazol-1-yl]-5-methanimidoyl-8-(oxetan-3-yl)-7H-pteridin-6-imine |
|---|---|
| PubChem CID | 123556404 |
| Molecular Formula | C21H21FN8O |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 7-ethyl-2-[2-(4-fluorophenyl)imidazol-1-yl]-5-methanimidoyl-8-(oxetan-3-yl)-7H-pteridin-6-imine |
| SMILES | [H]/N=C1/C(CC)N(C2COC2)c2nc(-n3ccnc3-c3ccc(F)cc3)ncc2N1/C=N/[H] |
| InChI | InChI=1S/C21H21FN8O/c1-2-16-18(24)29(12-23)17-9-26-21(27-20(17)30(16)15-10-31-11-15)28-8-7-25-19(28)13-3-5-14(22)6-4-13/h3-9,12,15-16,23-24H,2,10-11H2,1H3/b23-12+,24-18- |
| InChIKey | DEBKLAPLPMVWIS-VYQCIMFSSA-N |
| XLogP | 2.86 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|