C22H25N7O2 — CID 67261650
7-ethyl-5-methyl-8-(oxan-4-yl)-2-(2-pyridin-4-ylimidazol-1-yl)-7H-pteridin-6-one (PubChem CID 67261650) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 7-ethyl-5-methyl-8-(oxan-4-yl)-2-(2-pyridin-4-ylimidazol-1-yl)-7H-pteridin-6-one.
| Compound Name | 7-ethyl-5-methyl-8-(oxan-4-yl)-2-(2-pyridin-4-ylimidazol-1-yl)-7H-pteridin-6-one |
|---|---|
| PubChem CID | 67261650 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 7-ethyl-5-methyl-8-(oxan-4-yl)-2-(2-pyridin-4-ylimidazol-1-yl)-7H-pteridin-6-one |
| SMILES | CCC1C(=O)N(C)c2cnc(-n3ccnc3-c3ccncc3)nc2N1C1CCOCC1 |
| InChI | InChI=1S/C22H25N7O2/c1-3-17-21(30)27(2)18-14-25-22(26-20(18)29(17)16-6-12-31-13-7-16)28-11-10-24-19(28)15-4-8-23-9-5-15/h4-5,8-11,14,16-17H,3,6-7,12-13H2,1-2H3 |
| InChIKey | FZSGEFCDKPWSMD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |