C23H26N6O — CID 76777977
8-(1-cyclopropylethyl)-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-7H-pteridin-6-one (PubChem CID 76777977) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 8-(1-cyclopropylethyl)-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-7H-pteridin-6-one.
| Compound Name | 8-(1-cyclopropylethyl)-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-7H-pteridin-6-one |
|---|---|
| PubChem CID | 76777977 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 8-(1-cyclopropylethyl)-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-7H-pteridin-6-one |
| SMILES | CCC1C(=O)N(C)c2cnc(-n3ccnc3-c3ccccc3)nc2N1C(C)C1CC1 |
| InChI | InChI=1S/C23H26N6O/c1-4-18-22(30)27(3)19-14-25-23(26-21(19)29(18)15(2)16-10-11-16)28-13-12-24-20(28)17-8-6-5-7-9-17/h5-9,12-16,18H,4,10-11H2,1-3H3 |
| InChIKey | QNTWJIILWANRRF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |