C18H20ClN7O — CID 67260078
8-amino-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-7H-pteridin-6-one;hydrochloride (PubChem CID 67260078) has the molecular formula C18H20ClN7O and a molecular weight of 385.86 g/mol. Its IUPAC name is 8-amino-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-7H-pteridin-6-one;hydrochloride.
| Compound Name | 8-amino-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-7H-pteridin-6-one;hydrochloride |
|---|---|
| PubChem CID | 67260078 |
| Molecular Formula | C18H20ClN7O |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 8-amino-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-7H-pteridin-6-one;hydrochloride |
| SMILES | CCC1C(=O)N(C)c2cnc(-n3ccnc3-c3ccccc3)nc2N1N.Cl |
| InChI | InChI=1S/C18H19N7O.ClH/c1-3-13-17(26)23(2)14-11-21-18(22-16(14)25(13)19)24-10-9-20-15(24)12-7-5-4-6-8-12;/h4-11,13H,3,19H2,1-2H3;1H |
| InChIKey | SDWYVCCYBYIENL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|