C22H20N8O — CID 71602829
(7R)-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-8-pyrimidin-5-yl-7H-pteridin-6-one (PubChem CID 71602829) has the molecular formula C22H20N8O and a molecular weight of 412.46 g/mol. Its IUPAC name is (7R)-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-8-pyrimidin-5-yl-7H-pteridin-6-one.
| Compound Name | (7R)-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-8-pyrimidin-5-yl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 71602829 |
| Molecular Formula | C22H20N8O |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (7R)-7-ethyl-5-methyl-2-(2-phenylimidazol-1-yl)-8-pyrimidin-5-yl-7H-pteridin-6-one |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(-n3ccnc3-c3ccccc3)nc2N1c1cncnc1 |
| InChI | InChI=1S/C22H20N8O/c1-3-17-21(31)28(2)18-13-26-22(27-20(18)30(17)16-11-23-14-24-12-16)29-10-9-25-19(29)15-7-5-4-6-8-15/h4-14,17H,3H2,1-2H3/t17-/m1/s1 |
| InChIKey | HKSMOPLPIGGMTK-QGZVFWFLSA-N |
| XLogP | 3.01 |
| TPSA | 92.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |