C19H17ClN6O — CID 58405320
2-chloro-7-ethyl-5-methyl-8-(3-pyrimidin-5-ylphenyl)-7H-pteridin-6-one (PubChem CID 58405320) has the molecular formula C19H17ClN6O and a molecular weight of 380.84 g/mol. Its IUPAC name is 2-chloro-7-ethyl-5-methyl-8-(3-pyrimidin-5-ylphenyl)-7H-pteridin-6-one.
| Compound Name | 2-chloro-7-ethyl-5-methyl-8-(3-pyrimidin-5-ylphenyl)-7H-pteridin-6-one |
|---|---|
| PubChem CID | 58405320 |
| Molecular Formula | C19H17ClN6O |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-chloro-7-ethyl-5-methyl-8-(3-pyrimidin-5-ylphenyl)-7H-pteridin-6-one |
| SMILES | CCC1C(=O)N(C)c2cnc(Cl)nc2N1c1cccc(-c2cncnc2)c1 |
| InChI | InChI=1S/C19H17ClN6O/c1-3-15-18(27)25(2)16-10-23-19(20)24-17(16)26(15)14-6-4-5-12(7-14)13-8-21-11-22-9-13/h4-11,15H,3H2,1-2H3 |
| InChIKey | SGOXBNLFNIYJCK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |