C15H22ClN5O3 — CID 87301059
tert-butyl N-(2-chloro-7-ethyl-5-methyl-6-oxo-7H-pteridin-8-yl)-N-methylcarbamate (PubChem CID 87301059) has the molecular formula C15H22ClN5O3 and a molecular weight of 355.83 g/mol. Its IUPAC name is tert-butyl N-(2-chloro-7-ethyl-5-methyl-6-oxo-7H-pteridin-8-yl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(2-chloro-7-ethyl-5-methyl-6-oxo-7H-pteridin-8-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 87301059 |
| Molecular Formula | C15H22ClN5O3 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | tert-butyl N-(2-chloro-7-ethyl-5-methyl-6-oxo-7H-pteridin-8-yl)-N-methylcarbamate |
| SMILES | CCC1C(=O)N(C)c2cnc(Cl)nc2N1N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22ClN5O3/c1-7-9-12(22)19(5)10-8-17-13(16)18-11(10)21(9)20(6)14(23)24-15(2,3)4/h8-9H,7H2,1-6H3 |
| InChIKey | SIFSQSHALASDLE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |