C13H17ClN4O — CID 58405336
(7R)-2-chloro-8-(cyclopropylmethyl)-7-ethyl-5-methyl-7H-pteridin-6-one (PubChem CID 58405336) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is (7R)-2-chloro-8-(cyclopropylmethyl)-7-ethyl-5-methyl-7H-pteridin-6-one.
| Compound Name | (7R)-2-chloro-8-(cyclopropylmethyl)-7-ethyl-5-methyl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 58405336 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (7R)-2-chloro-8-(cyclopropylmethyl)-7-ethyl-5-methyl-7H-pteridin-6-one |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(Cl)nc2N1CC1CC1 |
| InChI | InChI=1S/C13H17ClN4O/c1-3-9-12(19)17(2)10-6-15-13(14)16-11(10)18(9)7-8-4-5-8/h6,8-9H,3-5,7H2,1-2H3/t9-/m1/s1 |
| InChIKey | PQJZOZXULJSUNX-SECBINFHSA-N |
| XLogP | 2.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |