C13H17ClN4O2 — CID 71603101
(7R)-2-chloro-7-ethyl-5-methyl-8-[(3R)-oxolan-3-yl]-7H-pteridin-6-one (PubChem CID 71603101) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is (7R)-2-chloro-7-ethyl-5-methyl-8-[(3R)-oxolan-3-yl]-7H-pteridin-6-one.
| Compound Name | (7R)-2-chloro-7-ethyl-5-methyl-8-[(3R)-oxolan-3-yl]-7H-pteridin-6-one |
|---|---|
| PubChem CID | 71603101 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (7R)-2-chloro-7-ethyl-5-methyl-8-[(3R)-oxolan-3-yl]-7H-pteridin-6-one |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(Cl)nc2N1[C@@H]1CCOC1 |
| InChI | InChI=1S/C13H17ClN4O2/c1-3-9-12(19)17(2)10-6-15-13(14)16-11(10)18(9)8-4-5-20-7-8/h6,8-9H,3-5,7H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | OKEMFFYKCCKRHM-RKDXNWHRSA-N |
| XLogP | 1.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |