About 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one
8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one (PubChem CID 123461562) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one.
Molecular Properties
| Compound Name | 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one |
| PubChem CID | 123461562 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one |
| SMILES | CCC1C(=O)N(C)c2cnc(C)nc2N1C(C)(C)C |
| InChI | InChI=1S/C14H22N4O/c1-7-10-13(19)17(6)11-8-15-9(2)16-12(11)18(10)14(3,4)5/h8,10H,7H2,1-6H3 |
| InChIKey | MYRNMBWOQDVJMI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one?
The IUPAC name of 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one (CID 123461562) is 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one.
What is the SMILES notation for 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one?
The canonical SMILES for 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one is CCC1C(=O)N(C)c2cnc(C)nc2N1C(C)(C)C.
What is the InChIKey of 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one?
The InChIKey is MYRNMBWOQDVJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O/c1-7-10-13(19)17(6)11-8-15-9(2)16-12(11)18(10)14(3,4)5/h8,10H,7H2,1-6H3.
What are the key properties of 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one?
8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one has a molecular weight of 262.36 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-7-ethyl-2,5-dimethyl-7H-pteridin-6-one is sourced from PubChem (CID 123461562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).