C12H20N6O — CID 58405428
(7R)-7-ethyl-2-hydrazinyl-5-methyl-8-propan-2-yl-7H-pteridin-6-one (PubChem CID 58405428) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is (7R)-7-ethyl-2-hydrazinyl-5-methyl-8-propan-2-yl-7H-pteridin-6-one.
| Compound Name | (7R)-7-ethyl-2-hydrazinyl-5-methyl-8-propan-2-yl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 58405428 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (7R)-7-ethyl-2-hydrazinyl-5-methyl-8-propan-2-yl-7H-pteridin-6-one |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(NN)nc2N1C(C)C |
| InChI | InChI=1S/C12H20N6O/c1-5-8-11(19)17(4)9-6-14-12(16-13)15-10(9)18(8)7(2)3/h6-8H,5,13H2,1-4H3,(H,14,15,16)/t8-/m1/s1 |
| InChIKey | NMYKXNKMZSBXTG-MRVPVSSYSA-N |
| XLogP | 0.73 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|