C26H36IN7O3 — CID 145208012
4-[[(7R)-8-tert-butyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-N-(1-iodopiperidin-4-yl)-3-methoxybenzamide (PubChem CID 145208012) has the molecular formula C26H36IN7O3 and a molecular weight of 621.52 g/mol. Its IUPAC name is 4-[[(7R)-8-tert-butyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-N-(1-iodopiperidin-4-yl)-3-methoxybenzamide.
| Compound Name | 4-[[(7R)-8-tert-butyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-N-(1-iodopiperidin-4-yl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 145208012 |
| Molecular Formula | C26H36IN7O3 |
| Molecular Weight | 621.52 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | 4-[[(7R)-8-tert-butyl-7-ethyl-5-methyl-6-oxo-7H-pteridin-2-yl]amino]-N-(1-iodopiperidin-4-yl)-3-methoxybenzamide |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(Nc3ccc(C(=O)NC4CCN(I)CC4)cc3OC)nc2N1C(C)(C)C |
| InChI | InChI=1S/C26H36IN7O3/c1-7-19-24(36)32(5)20-15-28-25(31-22(20)34(19)26(2,3)4)30-18-9-8-16(14-21(18)37-6)23(35)29-17-10-12-33(27)13-11-17/h8-9,14-15,17,19H,7,10-13H2,1-6H3,(H,29,35)(H,28,30,31)/t19-/m1/s1 |
| InChIKey | QUFSOEADAGXHBZ-LJQANCHMSA-N |
| XLogP | 4.13 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|