C28H41N7O3 — CID 163818079
4-[(9-butan-2-yl-5,7,8-trimethyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxy-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 163818079) has the molecular formula C28H41N7O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is 4-[(9-butan-2-yl-5,7,8-trimethyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxy-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-[(9-butan-2-yl-5,7,8-trimethyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxy-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 163818079 |
| Molecular Formula | C28H41N7O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | 4-[(9-butan-2-yl-5,7,8-trimethyl-6-oxo-7,8-dihydropyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxy-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CCC(C)N1c2nc(Nc3ccc(C(=O)NC4CCN(C)CC4)cc3OC)ncc2N(C)C(=O)C(C)C1C |
| InChI | InChI=1S/C28H41N7O3/c1-8-17(2)35-19(4)18(3)27(37)34(6)23-16-29-28(32-25(23)35)31-22-10-9-20(15-24(22)38-7)26(36)30-21-11-13-33(5)14-12-21/h9-10,15-19,21H,8,11-14H2,1-7H3,(H,30,36)(H,29,31,32) |
| InChIKey | NTAPIYCYAPUYAA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |