C22H29N5O4 — CID 143660516
4-[(7-ethyl-5-methyl-6-oxo-8-pentan-3-yl-7H-pteridin-2-yl)amino]-3-methoxybenzoic acid (PubChem CID 143660516) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is 4-[(7-ethyl-5-methyl-6-oxo-8-pentan-3-yl-7H-pteridin-2-yl)amino]-3-methoxybenzoic acid.
| Compound Name | 4-[(7-ethyl-5-methyl-6-oxo-8-pentan-3-yl-7H-pteridin-2-yl)amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 143660516 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 4-[(7-ethyl-5-methyl-6-oxo-8-pentan-3-yl-7H-pteridin-2-yl)amino]-3-methoxybenzoic acid |
| SMILES | CCC(CC)N1c2nc(Nc3ccc(C(=O)O)cc3OC)ncc2N(C)C(=O)C1CC |
| InChI | InChI=1S/C22H29N5O4/c1-6-14(7-2)27-16(8-3)20(28)26(4)17-12-23-22(25-19(17)27)24-15-10-9-13(21(29)30)11-18(15)31-5/h9-12,14,16H,6-8H2,1-5H3,(H,29,30)(H,23,24,25) |
| InChIKey | PGRWELHOUUSMPM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |