C24H21FN6O — CID 58405510
7-ethyl-2-[2-(4-fluorophenyl)imidazol-1-yl]-5-methyl-8-phenyl-7H-pteridin-6-one (PubChem CID 58405510) has the molecular formula C24H21FN6O and a molecular weight of 428.47 g/mol. Its IUPAC name is 7-ethyl-2-[2-(4-fluorophenyl)imidazol-1-yl]-5-methyl-8-phenyl-7H-pteridin-6-one.
| Compound Name | 7-ethyl-2-[2-(4-fluorophenyl)imidazol-1-yl]-5-methyl-8-phenyl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 58405510 |
| Molecular Formula | C24H21FN6O |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 7-ethyl-2-[2-(4-fluorophenyl)imidazol-1-yl]-5-methyl-8-phenyl-7H-pteridin-6-one |
| SMILES | CCC1C(=O)N(C)c2cnc(-n3ccnc3-c3ccc(F)cc3)nc2N1c1ccccc1 |
| InChI | InChI=1S/C24H21FN6O/c1-3-19-23(32)29(2)20-15-27-24(28-22(20)31(19)18-7-5-4-6-8-18)30-14-13-26-21(30)16-9-11-17(25)12-10-16/h4-15,19H,3H2,1-2H3 |
| InChIKey | JWXJJGCKWDRRIN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |