C22H22F2N8 — CID 67122133
(6aS)-2-[2-(3,5-difluorophenyl)imidazol-1-yl]-6a-ethyl-5-methanimidoyl-7,8,9,10-tetrahydropyrido[2,1-h]pteridin-6-imine (PubChem CID 67122133) has the molecular formula C22H22F2N8 and a molecular weight of 436.47 g/mol. Its IUPAC name is (6aS)-2-[2-(3,5-difluorophenyl)imidazol-1-yl]-6a-ethyl-5-methanimidoyl-7,8,9,10-tetrahydropyrido[2,1-h]pteridin-6-imine.
| Compound Name | (6aS)-2-[2-(3,5-difluorophenyl)imidazol-1-yl]-6a-ethyl-5-methanimidoyl-7,8,9,10-tetrahydropyrido[2,1-h]pteridin-6-imine |
|---|---|
| PubChem CID | 67122133 |
| Molecular Formula | C22H22F2N8 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (6aS)-2-[2-(3,5-difluorophenyl)imidazol-1-yl]-6a-ethyl-5-methanimidoyl-7,8,9,10-tetrahydropyrido[2,1-h]pteridin-6-imine |
| SMILES | [H]/N=C1\N(/C=N/[H])c2cnc(-n3ccnc3-c3cc(F)cc(F)c3)nc2N2CCCC[C@@]12CC |
| InChI | InChI=1S/C22H22F2N8/c1-2-22-5-3-4-7-32(22)19-17(31(13-25)20(22)26)12-28-21(29-19)30-8-6-27-18(30)14-9-15(23)11-16(24)10-14/h6,8-13,25-26H,2-5,7H2,1H3/b25-13+,26-20-/t22-/m0/s1 |
| InChIKey | ZNZMMDIGKXHWBI-KUBYQIFLSA-N |
| XLogP | 4.15 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|