C24H26N8 — CID 66979625
1-ethyl-5-methyl-10-(2-phenylimidazol-1-yl)-3,4,6,9,11,13-hexazatetracyclo[11.5.0.02,6.07,12]octadeca-2,4,7,9,11-pentaene (PubChem CID 66979625) has the molecular formula C24H26N8 and a molecular weight of 426.53 g/mol. Its IUPAC name is 1-ethyl-5-methyl-10-(2-phenylimidazol-1-yl)-3,4,6,9,11,13-hexazatetracyclo[11.5.0.02,6.07,12]octadeca-2,4,7,9,11-pentaene.
| Compound Name | 1-ethyl-5-methyl-10-(2-phenylimidazol-1-yl)-3,4,6,9,11,13-hexazatetracyclo[11.5.0.02,6.07,12]octadeca-2,4,7,9,11-pentaene |
|---|---|
| PubChem CID | 66979625 |
| Molecular Formula | C24H26N8 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 1-ethyl-5-methyl-10-(2-phenylimidazol-1-yl)-3,4,6,9,11,13-hexazatetracyclo[11.5.0.02,6.07,12]octadeca-2,4,7,9,11-pentaene |
| SMILES | CCC12CCCCCN1c1nc(-n3ccnc3-c3ccccc3)ncc1-n1c(C)nnc12 |
| InChI | InChI=1S/C24H26N8/c1-3-24-12-8-5-9-14-31(24)21-19(32-17(2)28-29-22(24)32)16-26-23(27-21)30-15-13-25-20(30)18-10-6-4-7-11-18/h4,6-7,10-11,13,15-16H,3,5,8-9,12,14H2,1-2H3 |
| InChIKey | GBTWBGXTTJOJEL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |