C24H23N7O — CID 67122040
(7R)-7-ethyl-3-methyl-15-(2-phenyl-3-pyridinyl)-9-oxa-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene (PubChem CID 67122040) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is (7R)-7-ethyl-3-methyl-15-(2-phenyl-3-pyridinyl)-9-oxa-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene.
| Compound Name | (7R)-7-ethyl-3-methyl-15-(2-phenyl-3-pyridinyl)-9-oxa-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene |
|---|---|
| PubChem CID | 67122040 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (7R)-7-ethyl-3-methyl-15-(2-phenyl-3-pyridinyl)-9-oxa-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene |
| SMILES | CC[C@@]12COCCN1c1nc(-c3cccnc3-c3ccccc3)ncc1-n1c(C)nnc12 |
| InChI | InChI=1S/C24H23N7O/c1-3-24-15-32-13-12-30(24)22-19(31-16(2)28-29-23(24)31)14-26-21(27-22)18-10-7-11-25-20(18)17-8-5-4-6-9-17/h4-11,14H,3,12-13,15H2,1-2H3/t24-/m0/s1 |
| InChIKey | WAIBRKRXLVYTMF-DEOSSOPVSA-N |
| XLogP | 3.55 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |