C22H23N9 — CID 67499363
(7R)-7-ethyl-9-methyl-15-(2-phenylimidazol-1-yl)-2,4,5,9,12,14,16-heptazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene (PubChem CID 67499363) has the molecular formula C22H23N9 and a molecular weight of 413.49 g/mol. Its IUPAC name is (7R)-7-ethyl-9-methyl-15-(2-phenylimidazol-1-yl)-2,4,5,9,12,14,16-heptazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene.
| Compound Name | (7R)-7-ethyl-9-methyl-15-(2-phenylimidazol-1-yl)-2,4,5,9,12,14,16-heptazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene |
|---|---|
| PubChem CID | 67499363 |
| Molecular Formula | C22H23N9 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (7R)-7-ethyl-9-methyl-15-(2-phenylimidazol-1-yl)-2,4,5,9,12,14,16-heptazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene |
| SMILES | CC[C@]12CN(C)CCN1c1nc(-n3ccnc3-c3ccccc3)ncc1-n1cnnc12 |
| InChI | InChI=1S/C22H23N9/c1-3-22-14-28(2)11-12-31(22)19-17(30-15-25-27-20(22)30)13-24-21(26-19)29-10-9-23-18(29)16-7-5-4-6-8-16/h4-10,13,15H,3,11-12,14H2,1-2H3/t22-/m1/s1 |
| InChIKey | VHTSHKPOROTAQP-JOCHJYFZSA-N |
| XLogP | 2.28 |
| TPSA | 80.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |