C22H19F3N8 — CID 67122155
(7R)-7-ethyl-15-[2-(3,4,5-trifluorophenyl)imidazol-1-yl]-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene (PubChem CID 67122155) has the molecular formula C22H19F3N8 and a molecular weight of 452.44 g/mol. Its IUPAC name is (7R)-7-ethyl-15-[2-(3,4,5-trifluorophenyl)imidazol-1-yl]-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene.
| Compound Name | (7R)-7-ethyl-15-[2-(3,4,5-trifluorophenyl)imidazol-1-yl]-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene |
|---|---|
| PubChem CID | 67122155 |
| Molecular Formula | C22H19F3N8 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (7R)-7-ethyl-15-[2-(3,4,5-trifluorophenyl)imidazol-1-yl]-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene |
| SMILES | CC[C@]12CCCCN1c1nc(-n3ccnc3-c3cc(F)c(F)c(F)c3)ncc1-n1cnnc12 |
| InChI | InChI=1S/C22H19F3N8/c1-2-22-5-3-4-7-33(22)19-16(32-12-28-30-20(22)32)11-27-21(29-19)31-8-6-26-18(31)13-9-14(23)17(25)15(24)10-13/h6,8-12H,2-5,7H2,1H3/t22-/m1/s1 |
| InChIKey | FXJFSAAKQCWKCH-JOCHJYFZSA-N |
| XLogP | 3.94 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|