C23H22F4N8 — CID 67122137
4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-1,4-dimethyl-5-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-f]pteridine (PubChem CID 67122137) has the molecular formula C23H22F4N8 and a molecular weight of 486.48 g/mol. Its IUPAC name is 4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-1,4-dimethyl-5-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-f]pteridine.
| Compound Name | 4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-1,4-dimethyl-5-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-f]pteridine |
|---|---|
| PubChem CID | 67122137 |
| Molecular Formula | C23H22F4N8 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 4-ethyl-7-[2-(4-fluorophenyl)imidazol-1-yl]-1,4-dimethyl-5-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-f]pteridine |
| SMILES | CCC1(C)c2nnc(C)n2-c2cnc(-n3ccnc3-c3ccc(F)cc3)nc2N1CCC(F)(F)F |
| InChI | InChI=1S/C23H22F4N8/c1-4-22(3)20-32-31-14(2)35(20)17-13-29-21(30-19(17)34(22)11-9-23(25,26)27)33-12-10-28-18(33)15-5-7-16(24)8-6-15/h5-8,10,12-13H,4,9,11H2,1-3H3 |
| InChIKey | XZESEAUNRZASRC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |