C22H17F7N8 — CID 87422911
7-[2-(4-fluorophenyl)imidazol-1-yl]-1-methyl-4-(2,2,2-trifluoroethyl)-5-(3,3,3-trifluoropropyl)-4H-[1,2,4]triazolo[4,3-f]pteridine (PubChem CID 87422911) has the molecular formula C22H17F7N8 and a molecular weight of 526.42 g/mol. Its IUPAC name is 7-[2-(4-fluorophenyl)imidazol-1-yl]-1-methyl-4-(2,2,2-trifluoroethyl)-5-(3,3,3-trifluoropropyl)-4H-[1,2,4]triazolo[4,3-f]pteridine.
| Compound Name | 7-[2-(4-fluorophenyl)imidazol-1-yl]-1-methyl-4-(2,2,2-trifluoroethyl)-5-(3,3,3-trifluoropropyl)-4H-[1,2,4]triazolo[4,3-f]pteridine |
|---|---|
| PubChem CID | 87422911 |
| Molecular Formula | C22H17F7N8 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 7-[2-(4-fluorophenyl)imidazol-1-yl]-1-methyl-4-(2,2,2-trifluoroethyl)-5-(3,3,3-trifluoropropyl)-4H-[1,2,4]triazolo[4,3-f]pteridine |
| SMILES | Cc1nnc2n1-c1cnc(-n3ccnc3-c3ccc(F)cc3)nc1N(CCC(F)(F)F)C2CC(F)(F)F |
| InChI | InChI=1S/C22H17F7N8/c1-12-33-34-19-15(10-22(27,28)29)35(8-6-21(24,25)26)18-16(37(12)19)11-31-20(32-18)36-9-7-30-17(36)13-2-4-14(23)5-3-13/h2-5,7,9,11,15H,6,8,10H2,1H3 |
| InChIKey | KDVHGWXTGFLNIX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |