C21H25F2N7O — CID 162554429
(7R)-8-cyclopentyl-N-[4-(difluoromethoxy)phenyl]-7-ethyl-6-imino-5-methanimidoyl-7H-pteridin-2-amine (PubChem CID 162554429) has the molecular formula C21H25F2N7O and a molecular weight of 429.48 g/mol. Its IUPAC name is (7R)-8-cyclopentyl-N-[4-(difluoromethoxy)phenyl]-7-ethyl-6-imino-5-methanimidoyl-7H-pteridin-2-amine.
| Compound Name | (7R)-8-cyclopentyl-N-[4-(difluoromethoxy)phenyl]-7-ethyl-6-imino-5-methanimidoyl-7H-pteridin-2-amine |
|---|---|
| PubChem CID | 162554429 |
| Molecular Formula | C21H25F2N7O |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (7R)-8-cyclopentyl-N-[4-(difluoromethoxy)phenyl]-7-ethyl-6-imino-5-methanimidoyl-7H-pteridin-2-amine |
| SMILES | [H]/N=C/N1/C(=N/[H])[C@@H](CC)N(C2CCCC2)c2nc(Nc3ccc(OC(F)F)cc3)ncc21 |
| InChI | InChI=1S/C21H25F2N7O/c1-2-16-18(25)29(12-24)17-11-26-21(28-19(17)30(16)14-5-3-4-6-14)27-13-7-9-15(10-8-13)31-20(22)23/h7-12,14,16,20,24-25H,2-6H2,1H3,(H,26,27,28)/b24-12+,25-18+/t16-/m1/s1 |
| InChIKey | YNEKKFOVHXWTMI-LZPJJYNCSA-N |
| XLogP | 4.75 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|