About 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine
2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine (PubChem CID 123734885) has the molecular formula C14H19ClN4
and a molecular weight of 278.79 g/mol. Its IUPAC name is 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine.
Molecular Properties
| Compound Name | 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine |
| PubChem CID | 123734885 |
| Molecular Formula | C14H19ClN4 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine |
| SMILES | C=C1C(C)N(C2CCCC2)c2nc(Cl)ncc2N1C |
| InChI | InChI=1S/C14H19ClN4/c1-9-10(2)19(11-6-4-5-7-11)13-12(18(9)3)8-16-14(15)17-13/h8,10-11H,1,4-7H2,2-3H3 |
| InChIKey | SJQJMTLXNIWUKD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine?
The IUPAC name of 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine (CID 123734885) is 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine.
What is the SMILES notation for 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine?
The canonical SMILES for 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine is C=C1C(C)N(C2CCCC2)c2nc(Cl)ncc2N1C.
What is the InChIKey of 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine?
The InChIKey is SJQJMTLXNIWUKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN4/c1-9-10(2)19(11-6-4-5-7-11)13-12(18(9)3)8-16-14(15)17-13/h8,10-11H,1,4-7H2,2-3H3.
What are the key properties of 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine?
2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine has a molecular weight of 278.79 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-8-cyclopentyl-5,7-dimethyl-6-methylidene-7H-pteridine is sourced from PubChem (CID 123734885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).