C16H21ClN4O — CID 174565816
(7R)-2-chloro-8-cyclopentyl-7-cyclopropyl-5-methyl-6,7-dihydropteridine-6-carbaldehyde (PubChem CID 174565816) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is (7R)-2-chloro-8-cyclopentyl-7-cyclopropyl-5-methyl-6,7-dihydropteridine-6-carbaldehyde.
| Compound Name | (7R)-2-chloro-8-cyclopentyl-7-cyclopropyl-5-methyl-6,7-dihydropteridine-6-carbaldehyde |
|---|---|
| PubChem CID | 174565816 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (7R)-2-chloro-8-cyclopentyl-7-cyclopropyl-5-methyl-6,7-dihydropteridine-6-carbaldehyde |
| SMILES | CN1c2cnc(Cl)nc2N(C2CCCC2)[C@H](C2CC2)C1C=O |
| InChI | InChI=1S/C16H21ClN4O/c1-20-12-8-18-16(17)19-15(12)21(11-4-2-3-5-11)14(10-6-7-10)13(20)9-22/h8-11,13-14H,2-7H2,1H3/t13?,14-/m1/s1 |
| InChIKey | LWEULTRHRUGVKU-ARLHGKGLSA-N |
| XLogP | 2.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|