C17H26ClN5O3 — CID 88868227
[1-[(6aR)-2-chloro-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]-4,4-dimethylpentan-3-yl]carbamic acid (PubChem CID 88868227) has the molecular formula C17H26ClN5O3 and a molecular weight of 383.88 g/mol. Its IUPAC name is [1-[(6aR)-2-chloro-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]-4,4-dimethylpentan-3-yl]carbamic acid.
| Compound Name | [1-[(6aR)-2-chloro-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]-4,4-dimethylpentan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 88868227 |
| Molecular Formula | C17H26ClN5O3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [1-[(6aR)-2-chloro-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]-4,4-dimethylpentan-3-yl]carbamic acid |
| SMILES | CC(C)(C)C(CCN1C[C@@H]2COCCN2c2nc(Cl)ncc21)NC(=O)O |
| InChI | InChI=1S/C17H26ClN5O3/c1-17(2,3)13(20-16(24)25)4-5-22-9-11-10-26-7-6-23(11)14-12(22)8-19-15(18)21-14/h8,11,13,20H,4-7,9-10H2,1-3H3,(H,24,25)/t11-,13?/m1/s1 |
| InChIKey | ROWOQVVTUZVXCC-JTDNENJMSA-N |
| XLogP | 2.23 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |