C21H32ClN5O3 — CID 88870035
tert-butyl N-[4-[(2-chloro-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl)methyl]cyclohexyl]carbamate (PubChem CID 88870035) has the molecular formula C21H32ClN5O3 and a molecular weight of 437.97 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-chloro-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl)methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-chloro-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl)methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 88870035 |
| Molecular Formula | C21H32ClN5O3 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | tert-butyl N-[4-[(2-chloro-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl)methyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CN2CC3COCCN3c3nc(Cl)ncc32)CC1 |
| InChI | InChI=1S/C21H32ClN5O3/c1-21(2,3)30-20(28)24-15-6-4-14(5-7-15)11-26-12-16-13-29-9-8-27(16)18-17(26)10-23-19(22)25-18/h10,14-16H,4-9,11-13H2,1-3H3,(H,24,28) |
| InChIKey | AUFMYQHEIDNEAS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |