C22H27N7O2 — CID 71023283
2-[(6aR)-2-(1H-indol-4-yl)-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]-N-(2-aminopropan-2-yl)acetamide (PubChem CID 71023283) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 2-[(6aR)-2-(1H-indol-4-yl)-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]-N-(2-aminopropan-2-yl)acetamide.
| Compound Name | 2-[(6aR)-2-(1H-indol-4-yl)-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]-N-(2-aminopropan-2-yl)acetamide |
|---|---|
| PubChem CID | 71023283 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 2-[(6aR)-2-(1H-indol-4-yl)-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]-N-(2-aminopropan-2-yl)acetamide |
| SMILES | CC(C)(N)NC(=O)CN1C[C@@H]2COCCN2c2nc(-c3cccc4[nH]ccc34)ncc21 |
| InChI | InChI=1S/C22H27N7O2/c1-22(2,23)27-19(30)12-28-11-14-13-31-9-8-29(14)21-18(28)10-25-20(26-21)16-4-3-5-17-15(16)6-7-24-17/h3-7,10,14,24H,8-9,11-13,23H2,1-2H3,(H,27,30)/t14-/m1/s1 |
| InChIKey | KMCDNRNWQLNTOJ-CQSZACIVSA-N |
| XLogP | 1.46 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|