C8H10I2N2O — CID 130508120
4,5-diiodo-1-(oxan-3-yl)imidazole (PubChem CID 130508120) has the molecular formula C8H10I2N2O and a molecular weight of 403.99 g/mol. Its IUPAC name is 4,5-diiodo-1-(oxan-3-yl)imidazole.
| Compound Name | 4,5-diiodo-1-(oxan-3-yl)imidazole |
|---|---|
| PubChem CID | 130508120 |
| Molecular Formula | C8H10I2N2O |
| Molecular Weight | 403.99 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | 4,5-diiodo-1-(oxan-3-yl)imidazole |
| SMILES | Ic1ncn(C2CCCOC2)c1I |
| InChI | InChI=1S/C8H10I2N2O/c9-7-8(10)12(5-11-7)6-2-1-3-13-4-6/h5-6H,1-4H2 |
| InChIKey | ZHVCVSBSAUHJMI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.99 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|